C24H27N5O2S2 — CID 4855187
2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 4855187) has the molecular formula C24H27N5O2S2 and a molecular weight of 481.65 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4855187 |
| Molecular Formula | C24H27N5O2S2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-(4-hexylphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCCCCc1ccc(-c2csc(NC(=O)CSc3nnc(-c4ccco4)n3C)n2)cc1 |
| InChI | InChI=1S/C24H27N5O2S2/c1-3-4-5-6-8-17-10-12-18(13-11-17)19-15-32-23(25-19)26-21(30)16-33-24-28-27-22(29(24)2)20-9-7-14-31-20/h7,9-15H,3-6,8,16H2,1-2H3,(H,25,26,30) |
| InChIKey | PRSWQWLIFZLDNB-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|