About N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide
N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide (PubChem CID 4855271) has the molecular formula C19H22BrN3O
and a molecular weight of 388.31 g/mol. Its IUPAC name is N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide |
| PubChem CID | 4855271 |
| Molecular Formula | C19H22BrN3O |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide |
| SMILES | Cc1ccc(N/C(=N/c2ccc(Br)cc2)N2CCOCC2)cc1C |
| InChI | InChI=1S/C19H22BrN3O/c1-14-3-6-18(13-15(14)2)22-19(23-9-11-24-12-10-23)21-17-7-4-16(20)5-8-17/h3-8,13H,9-12H2,1-2H3,(H,21,22) |
| InChIKey | UPTXRAZTDIKWML-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide?
The IUPAC name of N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide (CID 4855271) is N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide.
What is the SMILES notation for N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide?
The canonical SMILES for N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide is Cc1ccc(N/C(=N/c2ccc(Br)cc2)N2CCOCC2)cc1C.
What is the InChIKey of N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide?
The InChIKey is UPTXRAZTDIKWML-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22BrN3O/c1-14-3-6-18(13-15(14)2)22-19(23-9-11-24-12-10-23)21-17-7-4-16(20)5-8-17/h3-8,13H,9-12H2,1-2H3,(H,21,22).
What are the key properties of N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide?
N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide has a molecular weight of 388.31 g/mol, XLogP of 4.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-bromophenyl)-N-(3,4-dimethylphenyl)morpholine-4-carboximidamide is sourced from PubChem (CID 4855271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).