About [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate
[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate (PubChem CID 4855698) has the molecular formula C25H27N3O5
and a molecular weight of 449.51 g/mol. Its IUPAC name is [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate.
Molecular Properties
| Compound Name | [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
| PubChem CID | 4855698 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate |
| SMILES | CC(=O)c1ccc(OCCCC(=O)OCC(=O)Nc2c(C)nn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C25H27N3O5/c1-17-25(18(2)28(27-17)21-8-5-4-6-9-21)26-23(30)16-33-24(31)10-7-15-32-22-13-11-20(12-14-22)19(3)29/h4-6,8-9,11-14H,7,10,15-16H2,1-3H3,(H,26,30) |
| InChIKey | KFKRDXHRTCQJNO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate?
The IUPAC name of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate (CID 4855698) is [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate.
What is the SMILES notation for [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate?
The canonical SMILES for [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate is CC(=O)c1ccc(OCCCC(=O)OCC(=O)Nc2c(C)nn(-c3ccccc3)c2C)cc1.
What is the InChIKey of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate?
The InChIKey is KFKRDXHRTCQJNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27N3O5/c1-17-25(18(2)28(27-17)21-8-5-4-6-9-21)26-23(30)16-33-24(31)10-7-15-32-22-13-11-20(12-14-22)19(3)29/h4-6,8-9,11-14H,7,10,15-16H2,1-3H3,(H,26,30).
What are the key properties of [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate?
[2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate has a molecular weight of 449.51 g/mol, XLogP of 4.03, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)amino]-2-oxoethyl] 4-(4-acetylphenoxy)butanoate is sourced from PubChem (CID 4855698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).