About [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate
[2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate (PubChem CID 4855769) has the molecular formula C18H13Cl2N3O4
and a molecular weight of 406.23 g/mol. Its IUPAC name is [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate.
Molecular Properties
| Compound Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| PubChem CID | 4855769 |
| Molecular Formula | C18H13Cl2N3O4 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate |
| SMILES | Cn1nc(C(=O)OCC(=O)Nc2ccc(Cl)cc2Cl)c2ccccc2c1=O |
| InChI | InChI=1S/C18H13Cl2N3O4/c1-23-17(25)12-5-3-2-4-11(12)16(22-23)18(26)27-9-15(24)21-14-7-6-10(19)8-13(14)20/h2-8H,9H2,1H3,(H,21,24) |
| InChIKey | JDRJMHDYIJJQQG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate?
The IUPAC name of [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate (CID 4855769) is [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate.
What is the SMILES notation for [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate?
The canonical SMILES for [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate is Cn1nc(C(=O)OCC(=O)Nc2ccc(Cl)cc2Cl)c2ccccc2c1=O.
What is the InChIKey of [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate?
The InChIKey is JDRJMHDYIJJQQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13Cl2N3O4/c1-23-17(25)12-5-3-2-4-11(12)16(22-23)18(26)27-9-15(24)21-14-7-6-10(19)8-13(14)20/h2-8H,9H2,1H3,(H,21,24).
What are the key properties of [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate?
[2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate has a molecular weight of 406.23 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dichloroanilino)-2-oxoethyl] 3-methyl-4-oxophthalazine-1-carboxylate is sourced from PubChem (CID 4855769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).