About N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide
N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide (PubChem CID 48569535) has the molecular formula C14H16N2O5S2
and a molecular weight of 356.43 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 48569535 |
| Molecular Formula | C14H16N2O5S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide |
| SMILES | CCc1ncc(C(=O)NS(=O)(=O)c2cc(OC)ccc2OC)s1 |
| InChI | InChI=1S/C14H16N2O5S2/c1-4-13-15-8-11(22-13)14(17)16-23(18,19)12-7-9(20-2)5-6-10(12)21-3/h5-8H,4H2,1-3H3,(H,16,17) |
| InChIKey | SWWYHOPMMDULOX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide (CID 48569535) is N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide is CCc1ncc(C(=O)NS(=O)(=O)c2cc(OC)ccc2OC)s1.
What is the InChIKey of N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide?
The InChIKey is SWWYHOPMMDULOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O5S2/c1-4-13-15-8-11(22-13)14(17)16-23(18,19)12-7-9(20-2)5-6-10(12)21-3/h5-8H,4H2,1-3H3,(H,16,17).
What are the key properties of N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide?
N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide has a molecular weight of 356.43 g/mol, XLogP of 1.84, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethoxyphenyl)sulfonyl-2-ethyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 48569535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).