C20H18ClF2N3O4S — CID 4857462
2-chloro-N-[4-(difluoromethoxy)phenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 4857462) has the molecular formula C20H18ClF2N3O4S and a molecular weight of 469.90 g/mol. Its IUPAC name is 2-chloro-N-[4-(difluoromethoxy)phenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | 2-chloro-N-[4-(difluoromethoxy)phenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 4857462 |
| Molecular Formula | C20H18ClF2N3O4S |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 2-chloro-N-[4-(difluoromethoxy)phenyl]-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)c1cc2c(cc1Cl)N1CCCCCC1=NS2(=O)=O |
| InChI | InChI=1S/C20H18ClF2N3O4S/c21-15-11-16-17(31(28,29)25-18-4-2-1-3-9-26(16)18)10-14(15)19(27)24-12-5-7-13(8-6-12)30-20(22)23/h5-8,10-11,20H,1-4,9H2,(H,24,27) |
| InChIKey | CTELOSNCKUPJMZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |