About 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one
3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one (PubChem CID 4857536) has the molecular formula C16H23N3OS
and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
| PubChem CID | 4857536 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one |
| SMILES | CCCn1c(SCc2ccc(C(C)(C)C)cc2)n[nH]c1=O |
| InChI | InChI=1S/C16H23N3OS/c1-5-10-19-14(20)17-18-15(19)21-11-12-6-8-13(9-7-12)16(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,17,20) |
| InChIKey | KKPRJJSLDZQCNH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one (CID 4857536) is 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one is CCCn1c(SCc2ccc(C(C)(C)C)cc2)n[nH]c1=O.
What is the InChIKey of 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one?
The InChIKey is KKPRJJSLDZQCNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3OS/c1-5-10-19-14(20)17-18-15(19)21-11-12-6-8-13(9-7-12)16(2,3)4/h6-9H,5,10-11H2,1-4H3,(H,17,20).
What are the key properties of 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one?
3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one has a molecular weight of 305.45 g/mol, XLogP of 3.57, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-tert-butylphenyl)methylsulfanyl]-4-propyl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 4857536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).