C20H18F3N3O6S — CID 4857752
[2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate (PubChem CID 4857752) has the molecular formula C20H18F3N3O6S and a molecular weight of 485.44 g/mol. Its IUPAC name is [2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate.
| Compound Name | [2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 4857752 |
| Molecular Formula | C20H18F3N3O6S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 485.09 |
| IUPAC Name | [2-(2,2-dimethyl-3-oxo-4H-quinoxalin-1-yl)-2-oxoethyl] 2-[(2,3,4-trifluorophenyl)sulfonylamino]acetate |
| SMILES | CC1(C)C(=O)Nc2ccccc2N1C(=O)COC(=O)CNS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H18F3N3O6S/c1-20(2)19(29)25-12-5-3-4-6-13(12)26(20)15(27)10-32-16(28)9-24-33(30,31)14-8-7-11(21)17(22)18(14)23/h3-8,24H,9-10H2,1-2H3,(H,25,29) |
| InChIKey | LINHSJPCXCBHOC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|