C21H22ClNO4 — CID 4858827
6-chloro-7-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethoxy]-4-methylchromen-2-one (PubChem CID 4858827) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is 6-chloro-7-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethoxy]-4-methylchromen-2-one.
| Compound Name | 6-chloro-7-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 4858827 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 6-chloro-7-[2-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-oxoethoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)c3cc(C)n(C(C)C)c3C)c(Cl)cc12 |
| InChI | InChI=1S/C21H22ClNO4/c1-11(2)23-13(4)7-16(14(23)5)18(24)10-26-20-9-19-15(8-17(20)22)12(3)6-21(25)27-19/h6-9,11H,10H2,1-5H3 |
| InChIKey | PNBOSFXTWIWFDB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|