C21H24N4O4S — CID 4858996
2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 4858996) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 4858996 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)-N-[4-(4-methoxyphenyl)-5-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1ccc(-c2nc(NC(=O)CN3C(=O)NC4(CCCCC4)C3=O)sc2C)cc1 |
| InChI | InChI=1S/C21H24N4O4S/c1-13-17(14-6-8-15(29-2)9-7-14)23-19(30-13)22-16(26)12-25-18(27)21(24-20(25)28)10-4-3-5-11-21/h6-9H,3-5,10-12H2,1-2H3,(H,24,28)(H,22,23,26) |
| InChIKey | SBBJRKQJEQMUGV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|