About CID 4860344
CID 4860344 (PubChem CID 4860344) has the molecular formula C34H29N3O3
and a molecular weight of 527.62 g/mol.
Molecular Properties
| Compound Name | CID 4860344 |
| PubChem CID | 4860344 |
| Molecular Formula | C34H29N3O3 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1C)NC(=O)C21N2CCCC2C(C(=O)c2ccc3ccccc3c2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C34H29N3O3/c1-19-13-16-25-29(20(19)2)36-32(40)34(25)33(24-10-5-6-11-26(24)35-31(33)39)28(27-12-7-17-37(27)34)30(38)23-15-14-21-8-3-4-9-22(21)18-23/h3-6,8-11,13-16,18,27-28H,7,12,17H2,1-2H3,(H,35,39)(H,36,40) |
| InChIKey | YOTKJXYNGWBHAW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 4860344 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 4860344?
The IUPAC name of CID 4860344 (CID 4860344) is not available.
What is the SMILES notation for CID 4860344?
The canonical SMILES for CID 4860344 is Cc1ccc2c(c1C)NC(=O)C21N2CCCC2C(C(=O)c2ccc3ccccc3c2)C12C(=O)Nc1ccccc12.
What is the InChIKey of CID 4860344?
The InChIKey is YOTKJXYNGWBHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H29N3O3/c1-19-13-16-25-29(20(19)2)36-32(40)34(25)33(24-10-5-6-11-26(24)35-31(33)39)28(27-12-7-17-37(27)34)30(38)23-15-14-21-8-3-4-9-22(21)18-23/h3-6,8-11,13-16,18,27-28H,7,12,17H2,1-2H3,(H,35,39)(H,36,40).
What are the key properties of CID 4860344?
CID 4860344 has a molecular weight of 527.62 g/mol, XLogP of 5.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 4860344 is sourced from PubChem (CID 4860344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).