C17H15ClN4OS — CID 4860502
4-amino-5-(4-chlorophenyl)-2-sulfanylidene-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-6-one (PubChem CID 4860502) has the molecular formula C17H15ClN4OS and a molecular weight of 358.85 g/mol. Its IUPAC name is 4-amino-5-(4-chlorophenyl)-2-sulfanylidene-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-6-one.
| Compound Name | 4-amino-5-(4-chlorophenyl)-2-sulfanylidene-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 4860502 |
| Molecular Formula | C17H15ClN4OS |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-amino-5-(4-chlorophenyl)-2-sulfanylidene-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinolin-6-one |
| SMILES | Nc1[nH]c(=S)nc2c1C(c1ccc(Cl)cc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C17H15ClN4OS/c18-9-6-4-8(5-7-9)12-13-10(2-1-3-11(13)23)20-16-14(12)15(19)21-17(24)22-16/h4-7,12H,1-3H2,(H4,19,20,21,22,24) |
| InChIKey | OMJODQLIFVSOQF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|