About 4-aminopentan-2-one
4-aminopentan-2-one (PubChem CID 4861314) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is 4-aminopentan-2-one.
Molecular Properties
| Compound Name | 4-aminopentan-2-one |
| PubChem CID | 4861314 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | 4-aminopentan-2-one |
| SMILES | CC(=O)CC(C)N |
| InChI | InChI=1S/C5H11NO/c1-4(6)3-5(2)7/h4H,3,6H2,1-2H3 |
| InChIKey | PKFKYVFWCVEVCQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminopentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopentan-2-one?
The IUPAC name of 4-aminopentan-2-one (CID 4861314) is 4-aminopentan-2-one.
What is the SMILES notation for 4-aminopentan-2-one?
The canonical SMILES for 4-aminopentan-2-one is CC(=O)CC(C)N.
What is the InChIKey of 4-aminopentan-2-one?
The InChIKey is PKFKYVFWCVEVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO/c1-4(6)3-5(2)7/h4H,3,6H2,1-2H3.
What are the key properties of 4-aminopentan-2-one?
4-aminopentan-2-one has a molecular weight of 101.15 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopentan-2-one is sourced from PubChem (CID 4861314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).