C21H24FNO3 — CID 4861627
1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 4861627) has the molecular formula C21H24FNO3 and a molecular weight of 357.43 g/mol. Its IUPAC name is 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 4861627 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-(6-fluoro-2-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-4,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC1CCc2cc(F)ccc2N1C(=O)C12CCC(C)(C(=O)C1=O)C2(C)C |
| InChI | InChI=1S/C21H24FNO3/c1-12-5-6-13-11-14(22)7-8-15(13)23(12)18(26)21-10-9-20(4,19(21,2)3)16(24)17(21)25/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | ABARDPINZXVMIK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|