About (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate
(4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 4861806) has the molecular formula C18H22O2
and a molecular weight of 270.37 g/mol. Its IUPAC name is (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate.
Molecular Properties
| Compound Name | (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate |
| PubChem CID | 4861806 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | C=C1C2(C(=O)Oc3ccc(C)cc3)CCC(C2)C1(C)C |
| InChI | InChI=1S/C18H22O2/c1-12-5-7-15(8-6-12)20-16(19)18-10-9-14(11-18)17(3,4)13(18)2/h5-8,14H,2,9-11H2,1,3-4H3 |
| InChIKey | JTSRKKRFFUFEEX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate?
The IUPAC name of (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate (CID 4861806) is (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate.
What is the SMILES notation for (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate?
The canonical SMILES for (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate is C=C1C2(C(=O)Oc3ccc(C)cc3)CCC(C2)C1(C)C.
What is the InChIKey of (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate?
The InChIKey is JTSRKKRFFUFEEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22O2/c1-12-5-7-15(8-6-12)20-16(19)18-10-9-14(11-18)17(3,4)13(18)2/h5-8,14H,2,9-11H2,1,3-4H3.
What are the key properties of (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate?
(4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate has a molecular weight of 270.37 g/mol, XLogP of 4.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) 3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxylate is sourced from PubChem (CID 4861806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).