About propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate
propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate (PubChem CID 4861872) has the molecular formula C24H26O5
and a molecular weight of 394.47 g/mol. Its IUPAC name is propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate |
| PubChem CID | 4861872 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate |
| SMILES | CC(C)OC(=O)c1ccc2ccccc2c1OC(=O)C12CCC(C1)C(C)(C)C2=O |
| InChI | InChI=1S/C24H26O5/c1-14(2)28-20(25)18-10-9-15-7-5-6-8-17(15)19(18)29-22(27)24-12-11-16(13-24)23(3,4)21(24)26/h5-10,14,16H,11-13H2,1-4H3 |
| InChIKey | TWYFAUMPWIMZSR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
The IUPAC name of propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate (CID 4861872) is propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate.
What is the SMILES notation for propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
The canonical SMILES for propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate is CC(C)OC(=O)c1ccc2ccccc2c1OC(=O)C12CCC(C1)C(C)(C)C2=O.
What is the InChIKey of propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
The InChIKey is TWYFAUMPWIMZSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O5/c1-14(2)28-20(25)18-10-9-15-7-5-6-8-17(15)19(18)29-22(27)24-12-11-16(13-24)23(3,4)21(24)26/h5-10,14,16H,11-13H2,1-4H3.
What are the key properties of propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate?
propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate has a molecular weight of 394.47 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 1-(3,3-dimethyl-2-oxobicyclo[2.2.1]heptane-1-carbonyl)oxynaphthalene-2-carboxylate is sourced from PubChem (CID 4861872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).