C21H16N6O2S — CID 4862461
4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 4862461) has the molecular formula C21H16N6O2S and a molecular weight of 416.47 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 4862461 |
| Molecular Formula | C21H16N6O2S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-yl)-1H-pyrazol-5-yl]-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | c1cc2c(cc1-c1cc(-c3nc4c5c6c(sc5ncn4n3)CCCC6)[nH]n1)OCO2 |
| InChI | InChI=1S/C21H16N6O2S/c1-2-4-17-12(3-1)18-20-23-19(26-27(20)9-22-21(18)30-17)14-8-13(24-25-14)11-5-6-15-16(7-11)29-10-28-15/h5-9H,1-4,10H2,(H,24,25) |
| InChIKey | AACFTQMXOUFFMY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |