C14H11BrN6O3 — CID 4862486
N-(3-bromophenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 4862486) has the molecular formula C14H11BrN6O3 and a molecular weight of 391.19 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(3-bromophenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4862486 |
| Molecular Formula | C14H11BrN6O3 |
| Molecular Weight | 391.19 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | N-(3-bromophenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1ccn(Cn2cc([N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C14H11BrN6O3/c15-10-2-1-3-11(6-10)17-14(22)13-4-5-19(18-13)9-20-8-12(7-16-20)21(23)24/h1-8H,9H2,(H,17,22) |
| InChIKey | SOTGASJAMHPBSM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|