C24H28N4O6 — CID 4862695
3-N,5-N-bis[(3,5-dimethoxyphenyl)methyl]-1-methylpyrazole-3,5-dicarboxamide (PubChem CID 4862695) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-N,5-N-bis[(3,5-dimethoxyphenyl)methyl]-1-methylpyrazole-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis[(3,5-dimethoxyphenyl)methyl]-1-methylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 4862695 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 3-N,5-N-bis[(3,5-dimethoxyphenyl)methyl]-1-methylpyrazole-3,5-dicarboxamide |
| SMILES | COc1cc(CNC(=O)c2cc(C(=O)NCc3cc(OC)cc(OC)c3)n(C)n2)cc(OC)c1 |
| InChI | InChI=1S/C24H28N4O6/c1-28-22(24(30)26-14-16-8-19(33-4)11-20(9-16)34-5)12-21(27-28)23(29)25-13-15-6-17(31-2)10-18(7-15)32-3/h6-12H,13-14H2,1-5H3,(H,25,29)(H,26,30) |
| InChIKey | WIFVKGTZTQGKMJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |