C14H11N3O7 — CID 4863381
3,4,5-trihydroxy-N-[(2-hydroxy-3-nitrophenyl)methylideneamino]benzamide (PubChem CID 4863381) has the molecular formula C14H11N3O7 and a molecular weight of 333.26 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[(2-hydroxy-3-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[(2-hydroxy-3-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4863381 |
| Molecular Formula | C14H11N3O7 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3,4,5-trihydroxy-N-[(2-hydroxy-3-nitrophenyl)methylideneamino]benzamide |
| SMILES | O=C(NN=Cc1cccc([N+](=O)[O-])c1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C14H11N3O7/c18-10-4-8(5-11(19)13(10)21)14(22)16-15-6-7-2-1-3-9(12(7)20)17(23)24/h1-6,18-21H,(H,16,22) |
| InChIKey | OYTHYAAUUMPLGC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 165.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|