C26H26F2N2O10 — CID 4863613
[2,4,5-triacetyloxy-1,6-bis(2-fluoroanilino)-1,6-dioxohexan-3-yl] acetate (PubChem CID 4863613) has the molecular formula C26H26F2N2O10 and a molecular weight of 564.49 g/mol. Its IUPAC name is [2,4,5-triacetyloxy-1,6-bis(2-fluoroanilino)-1,6-dioxohexan-3-yl] acetate.
| Compound Name | [2,4,5-triacetyloxy-1,6-bis(2-fluoroanilino)-1,6-dioxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 4863613 |
| Molecular Formula | C26H26F2N2O10 |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.16 |
| IUPAC Name | [2,4,5-triacetyloxy-1,6-bis(2-fluoroanilino)-1,6-dioxohexan-3-yl] acetate |
| SMILES | CC(=O)OC(C(=O)Nc1ccccc1F)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C26H26F2N2O10/c1-13(31)37-21(23(39-15(3)33)25(35)29-19-11-7-5-9-17(19)27)22(38-14(2)32)24(40-16(4)34)26(36)30-20-12-8-6-10-18(20)28/h5-12,21-24H,1-4H3,(H,29,35)(H,30,36) |
| InChIKey | QWOGIDDHYRXPTD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|