C25H24N4O2 — CID 4865564
N-(1-benzyl-1,2,4-triazol-3-yl)-4-[(4-ethylphenoxy)methyl]benzamide (PubChem CID 4865564) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-4-[(4-ethylphenoxy)methyl]benzamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-4-[(4-ethylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 4865564 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-4-[(4-ethylphenoxy)methyl]benzamide |
| SMILES | CCc1ccc(OCc2ccc(C(=O)Nc3ncn(Cc4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C25H24N4O2/c1-2-19-10-14-23(15-11-19)31-17-21-8-12-22(13-9-21)24(30)27-25-26-18-29(28-25)16-20-6-4-3-5-7-20/h3-15,18H,2,16-17H2,1H3,(H,27,28,30) |
| InChIKey | XYYHSQGIWSBCHJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |