C19H32ClN5O2 — CID 48655928
5-chloro-2-(diethylamino)-N-(4-methyl-2-morpholin-4-ylpentyl)pyrimidine-4-carboxamide (PubChem CID 48655928) has the molecular formula C19H32ClN5O2 and a molecular weight of 397.95 g/mol. Its IUPAC name is 5-chloro-2-(diethylamino)-N-(4-methyl-2-morpholin-4-ylpentyl)pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-2-(diethylamino)-N-(4-methyl-2-morpholin-4-ylpentyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 48655928 |
| Molecular Formula | C19H32ClN5O2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 5-chloro-2-(diethylamino)-N-(4-methyl-2-morpholin-4-ylpentyl)pyrimidine-4-carboxamide |
| SMILES | CCN(CC)c1ncc(Cl)c(C(=O)NCC(CC(C)C)N2CCOCC2)n1 |
| InChI | InChI=1S/C19H32ClN5O2/c1-5-24(6-2)19-22-13-16(20)17(23-19)18(26)21-12-15(11-14(3)4)25-7-9-27-10-8-25/h13-15H,5-12H2,1-4H3,(H,21,26) |
| InChIKey | JNLYDNQQQGADRG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |