C33H56O11 — CID 4866756
methyl 2-ethyl-2-[3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]butanoate (PubChem CID 4866756) has the molecular formula C33H56O11 and a molecular weight of 628.80 g/mol. Its IUPAC name is methyl 2-ethyl-2-[3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]butanoate.
| Compound Name | methyl 2-ethyl-2-[3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]butanoate |
|---|---|
| PubChem CID | 4866756 |
| Molecular Formula | C33H56O11 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | methyl 2-ethyl-2-[3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(2,2-dimethylpropanoyloxymethyl)oxan-2-yl]butanoate |
| SMILES | CCC(CC)(C(=O)OC)C1OC(COC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C(OC(=O)C(C)(C)C)C1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C33H56O11/c1-16-33(17-2,28(38)39-15)23-22(44-27(37)32(12,13)14)21(43-26(36)31(9,10)11)20(42-25(35)30(6,7)8)19(41-23)18-40-24(34)29(3,4)5/h19-23H,16-18H2,1-15H3 |
| InChIKey | YCSJYWJBMSYIAB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|