C15H24O4Si — CID 4866796
(3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl) acetate (PubChem CID 4866796) has the molecular formula C15H24O4Si and a molecular weight of 296.44 g/mol. Its IUPAC name is (3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl) acetate.
| Compound Name | (3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl) acetate |
|---|---|
| PubChem CID | 4866796 |
| Molecular Formula | C15H24O4Si |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3-prop-2-enoxy-4-trimethylsilyl-3,5,6,6a-tetrahydro-1H-cyclopenta[c]furan-5-yl) acetate |
| SMILES | C=CCOC1OCC2CC(OC(C)=O)C([Si](C)(C)C)=C21 |
| InChI | InChI=1S/C15H24O4Si/c1-6-7-17-15-13-11(9-18-15)8-12(19-10(2)16)14(13)20(3,4)5/h6,11-12,15H,1,7-9H2,2-5H3 |
| InChIKey | MQNHNLPAXGPWLO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|