About 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide
4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide (PubChem CID 4866974) has the molecular formula C19H20N4O2S
and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide.
Molecular Properties
| Compound Name | 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide |
| PubChem CID | 4866974 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide |
| SMILES | CCc1ccc(OCc2ccc(C(=O)Nn3cnnc3SC)cc2)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-3-14-6-10-17(11-7-14)25-12-15-4-8-16(9-5-15)18(24)22-23-13-20-21-19(23)26-2/h4-11,13H,3,12H2,1-2H3,(H,22,24) |
| InChIKey | VFJGLTGMOFLZTR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide?
The IUPAC name of 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide (CID 4866974) is 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide.
What is the SMILES notation for 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide?
The canonical SMILES for 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide is CCc1ccc(OCc2ccc(C(=O)Nn3cnnc3SC)cc2)cc1.
What is the InChIKey of 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide?
The InChIKey is VFJGLTGMOFLZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O2S/c1-3-14-6-10-17(11-7-14)25-12-15-4-8-16(9-5-15)18(24)22-23-13-20-21-19(23)26-2/h4-11,13H,3,12H2,1-2H3,(H,22,24).
What are the key properties of 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide?
4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide has a molecular weight of 368.46 g/mol, XLogP of 3.53, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethylphenoxy)methyl]-N-(3-methylsulfanyl-1,2,4-triazol-4-yl)benzamide is sourced from PubChem (CID 4866974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).