C24H24N2O4 — CID 48673523
2-[4-[2-(3-benzyl-4-methoxyanilino)-2-oxoethoxy]phenyl]acetamide (PubChem CID 48673523) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-[4-[2-(3-benzyl-4-methoxyanilino)-2-oxoethoxy]phenyl]acetamide.
| Compound Name | 2-[4-[2-(3-benzyl-4-methoxyanilino)-2-oxoethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 48673523 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[4-[2-(3-benzyl-4-methoxyanilino)-2-oxoethoxy]phenyl]acetamide |
| SMILES | COc1ccc(NC(=O)COc2ccc(CC(N)=O)cc2)cc1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N2O4/c1-29-22-12-9-20(15-19(22)13-17-5-3-2-4-6-17)26-24(28)16-30-21-10-7-18(8-11-21)14-23(25)27/h2-12,15H,13-14,16H2,1H3,(H2,25,27)(H,26,28) |
| InChIKey | WEOJUNBMFMYEMY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |