C20H28N2O4 — CID 4867506
2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 4867506) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | 2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 4867506 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 2-[(1-carboxy-7,7-dimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC1(C)C2CCC1(C(=O)O)C(=NN=C1CC3CCC1(C(=O)O)C3(C)C)C2 |
| InChI | InChI=1S/C20H28N2O4/c1-17(2)11-5-7-19(17,15(23)24)13(9-11)21-22-14-10-12-6-8-20(14,16(25)26)18(12,3)4/h11-12H,5-10H2,1-4H3,(H,23,24)(H,25,26) |
| InChIKey | LRKSMRDFDQPWSU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|