C14H13Cl3N2O3 — CID 4867510
2,6,7-trichloro-3-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)imidazo[1,2-a]pyridine (PubChem CID 4867510) has the molecular formula C14H13Cl3N2O3 and a molecular weight of 363.63 g/mol. Its IUPAC name is 2,6,7-trichloro-3-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)imidazo[1,2-a]pyridine.
| Compound Name | 2,6,7-trichloro-3-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 4867510 |
| Molecular Formula | C14H13Cl3N2O3 |
| Molecular Weight | 363.63 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 2,6,7-trichloro-3-(2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl)imidazo[1,2-a]pyridine |
| SMILES | CC1(C)OC2COC(c3c(Cl)nc4cc(Cl)c(Cl)cn34)C2O1 |
| InChI | InChI=1S/C14H13Cl3N2O3/c1-14(2)21-8-5-20-12(11(8)22-14)10-13(17)18-9-3-6(15)7(16)4-19(9)10/h3-4,8,11-12H,5H2,1-2H3 |
| InChIKey | OZBCXUGRKCYZGQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |