About 3,5-dimethylpyrazolidine
3,5-dimethylpyrazolidine (PubChem CID 4867587) has the molecular formula C5H12N2
and a molecular weight of 100.16 g/mol. Its IUPAC name is 3,5-dimethylpyrazolidine.
Molecular Properties
| Compound Name | 3,5-dimethylpyrazolidine |
| PubChem CID | 4867587 |
| Molecular Formula | C5H12N2 |
| Molecular Weight | 100.16 g/mol |
| Exact Mass | 100.10 |
| IUPAC Name | 3,5-dimethylpyrazolidine |
| SMILES | CC1CC(C)NN1 |
| InChI | InChI=1S/C5H12N2/c1-4-3-5(2)7-6-4/h4-7H,3H2,1-2H3 |
| InChIKey | LOQWPQZICQOFOO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.16 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethylpyrazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylpyrazolidine?
The IUPAC name of 3,5-dimethylpyrazolidine (CID 4867587) is 3,5-dimethylpyrazolidine.
What is the SMILES notation for 3,5-dimethylpyrazolidine?
The canonical SMILES for 3,5-dimethylpyrazolidine is CC1CC(C)NN1.
What is the InChIKey of 3,5-dimethylpyrazolidine?
The InChIKey is LOQWPQZICQOFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2/c1-4-3-5(2)7-6-4/h4-7H,3H2,1-2H3.
What are the key properties of 3,5-dimethylpyrazolidine?
3,5-dimethylpyrazolidine has a molecular weight of 100.16 g/mol, XLogP of 0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylpyrazolidine is sourced from PubChem (CID 4867587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).