C19H19F2N3O2S — CID 4867894
3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(2-phenylethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4867894) has the molecular formula C19H19F2N3O2S and a molecular weight of 391.44 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(2-phenylethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4867894 |
| Molecular Formula | C19H19F2N3O2S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(2-phenylethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(-c2n[nH]c(=S)n2CCc2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F2N3O2S/c1-2-25-16-12-14(8-9-15(16)26-18(20)21)17-22-23-19(27)24(17)11-10-13-6-4-3-5-7-13/h3-9,12,18H,2,10-11H2,1H3,(H,23,27) |
| InChIKey | BUZZBMXUVSXCAH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|