C15H19F2N3O3S — CID 4867940
3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione (PubChem CID 4867940) has the molecular formula C15H19F2N3O3S and a molecular weight of 359.40 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4867940 |
| Molecular Formula | C15H19F2N3O3S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 3-[4-(difluoromethoxy)-3-ethoxyphenyl]-4-(3-methoxypropyl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(-c2n[nH]c(=S)n2CCCOC)ccc1OC(F)F |
| InChI | InChI=1S/C15H19F2N3O3S/c1-3-22-12-9-10(5-6-11(12)23-14(16)17)13-18-19-15(24)20(13)7-4-8-21-2/h5-6,9,14H,3-4,7-8H2,1-2H3,(H,19,24) |
| InChIKey | ARSKLTSGYTYHKE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|