About 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone
1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone (PubChem CID 48681061) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone.
Molecular Properties
| Compound Name | 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone |
| PubChem CID | 48681061 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone |
| SMILES | CCCOCC(=O)N1CCCN(CCOC)CC1 |
| InChI | InChI=1S/C13H26N2O3/c1-3-10-18-12-13(16)15-6-4-5-14(7-8-15)9-11-17-2/h3-12H2,1-2H3 |
| InChIKey | YGUKNNICYXGCGK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone?
The IUPAC name of 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone (CID 48681061) is 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone.
What is the SMILES notation for 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone?
The canonical SMILES for 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone is CCCOCC(=O)N1CCCN(CCOC)CC1.
What is the InChIKey of 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone?
The InChIKey is YGUKNNICYXGCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-3-10-18-12-13(16)15-6-4-5-14(7-8-15)9-11-17-2/h3-12H2,1-2H3.
What are the key properties of 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone?
1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone has a molecular weight of 258.36 g/mol, XLogP of 0.59, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2-methoxyethyl)-1,4-diazepan-1-yl]-2-propoxyethanone is sourced from PubChem (CID 48681061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).