C21H27N3O4S — CID 48681424
(2S)-2-(benzenesulfonamido)-N-[1-(4-morpholin-4-ylphenyl)ethyl]propanamide (PubChem CID 48681424) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-N-[1-(4-morpholin-4-ylphenyl)ethyl]propanamide.
| Compound Name | (2S)-2-(benzenesulfonamido)-N-[1-(4-morpholin-4-ylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 48681424 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-N-[1-(4-morpholin-4-ylphenyl)ethyl]propanamide |
| SMILES | CC(NC(=O)[C@H](C)NS(=O)(=O)c1ccccc1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27N3O4S/c1-16(18-8-10-19(11-9-18)24-12-14-28-15-13-24)22-21(25)17(2)23-29(26,27)20-6-4-3-5-7-20/h3-11,16-17,23H,12-15H2,1-2H3,(H,22,25)/t16?,17-/m0/s1 |
| InChIKey | LHTKSGVYPPBOPZ-DJNXLDHESA-N |
| XLogP | 2.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|