About 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one
5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 4868402) has the molecular formula C10H9FO2
and a molecular weight of 180.18 g/mol. Its IUPAC name is 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 4868402 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2c(F)ccc(O)c21 |
| InChI | InChI=1S/C10H9FO2/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h4-5,13H,1-3H2 |
| InChIKey | JNKSZGDYTZWOFB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one (CID 4868402) is 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one is O=C1CCCc2c(F)ccc(O)c21.
What is the InChIKey of 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is JNKSZGDYTZWOFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO2/c11-7-4-5-9(13)10-6(7)2-1-3-8(10)12/h4-5,13H,1-3H2.
What are the key properties of 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one?
5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 180.18 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-8-hydroxy-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 4868402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).