C27H23F3N4OS — CID 4868478
phenyl-[3-(2-phenylpropyl)-6-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone (PubChem CID 4868478) has the molecular formula C27H23F3N4OS and a molecular weight of 508.57 g/mol. Its IUPAC name is phenyl-[3-(2-phenylpropyl)-6-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone.
| Compound Name | phenyl-[3-(2-phenylpropyl)-6-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
|---|---|
| PubChem CID | 4868478 |
| Molecular Formula | C27H23F3N4OS |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | phenyl-[3-(2-phenylpropyl)-6-[4-(trifluoromethyl)phenyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-7-yl]methanone |
| SMILES | CC(Cc1nnc2n1NC(c1ccc(C(F)(F)F)cc1)C(C(=O)c1ccccc1)S2)c1ccccc1 |
| InChI | InChI=1S/C27H23F3N4OS/c1-17(18-8-4-2-5-9-18)16-22-31-32-26-34(22)33-23(19-12-14-21(15-13-19)27(28,29)30)25(36-26)24(35)20-10-6-3-7-11-20/h2-15,17,23,25,33H,16H2,1H3 |
| InChIKey | FRFJVXABCFWAMA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |