C14H18N2O3 — CID 48685478
2-(2-cyanophenoxy)-N-(3-methoxy-2-methylpropyl)acetamide (PubChem CID 48685478) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-(3-methoxy-2-methylpropyl)acetamide.
| Compound Name | 2-(2-cyanophenoxy)-N-(3-methoxy-2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 48685478 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-(3-methoxy-2-methylpropyl)acetamide |
| SMILES | COCC(C)CNC(=O)COc1ccccc1C#N |
| InChI | InChI=1S/C14H18N2O3/c1-11(9-18-2)8-16-14(17)10-19-13-6-4-3-5-12(13)7-15/h3-6,11H,8-10H2,1-2H3,(H,16,17) |
| InChIKey | NUBGGQJFICEKBP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |