C18H31N3O6 — CID 4868836
2-[[4-[[(2-amino-4-methylpentanoyl)amino]methyl]cyclohexanecarbonyl]amino]butanedioic acid (PubChem CID 4868836) has the molecular formula C18H31N3O6 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[[4-[[(2-amino-4-methylpentanoyl)amino]methyl]cyclohexanecarbonyl]amino]butanedioic acid.
| Compound Name | 2-[[4-[[(2-amino-4-methylpentanoyl)amino]methyl]cyclohexanecarbonyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 4868836 |
| Molecular Formula | C18H31N3O6 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2-[[4-[[(2-amino-4-methylpentanoyl)amino]methyl]cyclohexanecarbonyl]amino]butanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NCC1CCC(C(=O)NC(CC(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C18H31N3O6/c1-10(2)7-13(19)17(25)20-9-11-3-5-12(6-4-11)16(24)21-14(18(26)27)8-15(22)23/h10-14H,3-9,19H2,1-2H3,(H,20,25)(H,21,24)(H,22,23)(H,26,27) |
| InChIKey | HMCNDXUJSPJJJA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |