C21H22N4O6 — CID 4870085
4-[(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)amino]-4-oxobut-2-enoic acid (PubChem CID 4870085) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is 4-[(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 4870085 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-[(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)amino]-4-oxobut-2-enoic acid |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3cc(NC(=O)C=CC(=O)O)ccc3N3CCCC32)C1=O |
| InChI | InChI=1S/C21H22N4O6/c1-23-18(29)21(19(30)24(2)20(23)31)11-12-10-13(22-16(26)7-8-17(27)28)5-6-14(12)25-9-3-4-15(21)25/h5-8,10,15H,3-4,9,11H2,1-2H3,(H,22,26)(H,27,28) |
| InChIKey | CIZNNSMPQWUGIF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|