C16H20N2O3 — CID 4870192
(2,6-dimethylmorpholin-4-yl)-(6-methoxy-1H-indol-2-yl)methanone (PubChem CID 4870192) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (2,6-dimethylmorpholin-4-yl)-(6-methoxy-1H-indol-2-yl)methanone.
| Compound Name | (2,6-dimethylmorpholin-4-yl)-(6-methoxy-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 4870192 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (2,6-dimethylmorpholin-4-yl)-(6-methoxy-1H-indol-2-yl)methanone |
| SMILES | COc1ccc2cc(C(=O)N3CC(C)OC(C)C3)[nH]c2c1 |
| InChI | InChI=1S/C16H20N2O3/c1-10-8-18(9-11(2)21-10)16(19)15-6-12-4-5-13(20-3)7-14(12)17-15/h4-7,10-11,17H,8-9H2,1-3H3 |
| InChIKey | HDMVNNLCPSBGGL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |