C25H19FN4O4S — CID 4870918
5-fluoro-7'-(3-nitrophenyl)-6'-(pyridine-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one (PubChem CID 4870918) has the molecular formula C25H19FN4O4S and a molecular weight of 490.52 g/mol. Its IUPAC name is 5-fluoro-7'-(3-nitrophenyl)-6'-(pyridine-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one.
| Compound Name | 5-fluoro-7'-(3-nitrophenyl)-6'-(pyridine-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
|---|---|
| PubChem CID | 4870918 |
| Molecular Formula | C25H19FN4O4S |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | 5-fluoro-7'-(3-nitrophenyl)-6'-(pyridine-2-carbonyl)spiro[1H-indole-3,5'-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazole]-2-one |
| SMILES | O=C(c1ccccn1)C1C(c2cccc([N+](=O)[O-])c2)C2CSCN2C12C(=O)Nc1ccc(F)cc12 |
| InChI | InChI=1S/C25H19FN4O4S/c26-15-7-8-18-17(11-15)25(24(32)28-18)22(23(31)19-6-1-2-9-27-19)21(20-12-35-13-29(20)25)14-4-3-5-16(10-14)30(33)34/h1-11,20-22H,12-13H2,(H,28,32) |
| InChIKey | SVAIFRRTLZBRDN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|