C19H16FN5O3S — CID 4871054
2-[[4-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]-7,8-dimethoxyphthalazin-1-one (PubChem CID 4871054) has the molecular formula C19H16FN5O3S and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[[4-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]-7,8-dimethoxyphthalazin-1-one.
| Compound Name | 2-[[4-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]-7,8-dimethoxyphthalazin-1-one |
|---|---|
| PubChem CID | 4871054 |
| Molecular Formula | C19H16FN5O3S |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 2-[[4-(2-fluorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]-7,8-dimethoxyphthalazin-1-one |
| SMILES | COc1ccc2cnn(Cc3n[nH]c(=S)n3-c3ccccc3F)c(=O)c2c1OC |
| InChI | InChI=1S/C19H16FN5O3S/c1-27-14-8-7-11-9-21-24(18(26)16(11)17(14)28-2)10-15-22-23-19(29)25(15)13-6-4-3-5-12(13)20/h3-9H,10H2,1-2H3,(H,23,29) |
| InChIKey | SSAXOMZDUMNUSH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|