C22H38N2O — CID 4871104
N-[3-(2,2-dimethyloxan-4-yl)-4-phenylbutyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 4871104) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is N-[3-(2,2-dimethyloxan-4-yl)-4-phenylbutyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[3-(2,2-dimethyloxan-4-yl)-4-phenylbutyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4871104 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | N-[3-(2,2-dimethyloxan-4-yl)-4-phenylbutyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCCC(Cc1ccccc1)C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C22H38N2O/c1-22(2)18-21(12-16-25-22)20(17-19-9-6-5-7-10-19)11-14-23-13-8-15-24(3)4/h5-7,9-10,20-21,23H,8,11-18H2,1-4H3 |
| InChIKey | NUXBPJRERSFVCH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|