About methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate
methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate (PubChem CID 4871578) has the molecular formula C18H15N3O6S2
and a molecular weight of 433.47 g/mol. Its IUPAC name is methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate |
| PubChem CID | 4871578 |
| Molecular Formula | C18H15N3O6S2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.04 |
| IUPAC Name | methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)ccc2c1NS(=O)(=O)c1ccc2[nH]c(=O)sc2c1 |
| InChI | InChI=1S/C18H15N3O6S2/c1-26-9-3-5-11-13(7-9)19-16(17(22)27-2)15(11)21-29(24,25)10-4-6-12-14(8-10)28-18(23)20-12/h3-8,19,21H,1-2H3,(H,20,23) |
| InChIKey | HFMKUPZLJOCZKP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate?
The IUPAC name of methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate (CID 4871578) is methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate.
What is the SMILES notation for methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate?
The canonical SMILES for methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate is COC(=O)c1[nH]c2cc(OC)ccc2c1NS(=O)(=O)c1ccc2[nH]c(=O)sc2c1.
What is the InChIKey of methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate?
The InChIKey is HFMKUPZLJOCZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O6S2/c1-26-9-3-5-11-13(7-9)19-16(17(22)27-2)15(11)21-29(24,25)10-4-6-12-14(8-10)28-18(23)20-12/h3-8,19,21H,1-2H3,(H,20,23).
What are the key properties of methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate?
methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate has a molecular weight of 433.47 g/mol, XLogP of 2.67, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methoxy-3-[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]-1H-indole-2-carboxylate is sourced from PubChem (CID 4871578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).