C33H24ClNO5S — CID 4872622
7-chloro-2-(2,3-dimethoxyphenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 4872622) has the molecular formula C33H24ClNO5S and a molecular weight of 582.08 g/mol. Its IUPAC name is 7-chloro-2-(2,3-dimethoxyphenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | 7-chloro-2-(2,3-dimethoxyphenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 4872622 |
| Molecular Formula | C33H24ClNO5S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 7-chloro-2-(2,3-dimethoxyphenyl)-1-(thiophene-2-carbonyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | COc1cccc(C2C(C(=O)c3cccs3)N3c4ccc(Cl)cc4C=CC3C23C(=O)c2ccccc2C3=O)c1OC |
| InChI | InChI=1S/C33H24ClNO5S/c1-39-24-10-5-9-22(30(24)40-2)27-28(29(36)25-11-6-16-41-25)35-23-14-13-19(34)17-18(23)12-15-26(35)33(27)31(37)20-7-3-4-8-21(20)32(33)38/h3-17,26-28H,1-2H3 |
| InChIKey | GJQQSPIARPGEMY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|