C13H17N3O3S — CID 48731548
7a-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 48731548) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is 7a-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 7a-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 48731548 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 7a-methyl-N-[(3-methyl-1,2-oxazol-5-yl)methyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | Cc1cc(CNC(=O)C2CSC3(C)CCC(=O)N23)on1 |
| InChI | InChI=1S/C13H17N3O3S/c1-8-5-9(19-15-8)6-14-12(18)10-7-20-13(2)4-3-11(17)16(10)13/h5,10H,3-4,6-7H2,1-2H3,(H,14,18) |
| InChIKey | RPLXKDJQJJGAAB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |