C14H9ClF3N5OS — CID 4873431
2-[3-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carbohydrazide (PubChem CID 4873431) has the molecular formula C14H9ClF3N5OS and a molecular weight of 387.77 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-[3-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 4873431 |
| Molecular Formula | C14H9ClF3N5OS |
| Molecular Weight | 387.77 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-5-(trifluoromethyl)pyrazol-1-yl]-1,3-thiazole-4-carbohydrazide |
| SMILES | NNC(=O)c1csc(-n2nc(-c3ccc(Cl)cc3)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H9ClF3N5OS/c15-8-3-1-7(2-4-8)9-5-11(14(16,17)18)23(22-9)13-20-10(6-25-13)12(24)21-19/h1-6H,19H2,(H,21,24) |
| InChIKey | QLWKIMPOVBOMLE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|