C17H19N5S — CID 48736147
6-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine (PubChem CID 48736147) has the molecular formula C17H19N5S and a molecular weight of 325.44 g/mol. Its IUPAC name is 6-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine.
| Compound Name | 6-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
|---|---|
| PubChem CID | 48736147 |
| Molecular Formula | C17H19N5S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 6-methyl-N-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]imidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| SMILES | Cc1cc(CNc2nn3cc(C)nc3s2)c2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C17H19N5S/c1-9-5-13(15-14(6-9)11(3)12(4)20-15)7-18-16-21-22-8-10(2)19-17(22)23-16/h5-6,8,20H,7H2,1-4H3,(H,18,21) |
| InChIKey | JDDHGOUXTKWNLF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|