About 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine
4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 4874050) has the molecular formula C12H20ClN5O
and a molecular weight of 285.78 g/mol. Its IUPAC name is 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| PubChem CID | 4874050 |
| Molecular Formula | C12H20ClN5O |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | CN(C)c1nc(OCCCl)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H20ClN5O/c1-17(2)10-14-11(18-7-4-3-5-8-18)16-12(15-10)19-9-6-13/h3-9H2,1-2H3 |
| InChIKey | XACLUMQMWXVDFB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine?
The IUPAC name of 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine (CID 4874050) is 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine?
The canonical SMILES for 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine is CN(C)c1nc(OCCCl)nc(N2CCCCC2)n1.
What is the InChIKey of 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine?
The InChIKey is XACLUMQMWXVDFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20ClN5O/c1-17(2)10-14-11(18-7-4-3-5-8-18)16-12(15-10)19-9-6-13/h3-9H2,1-2H3.
What are the key properties of 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine?
4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine has a molecular weight of 285.78 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethoxy)-N,N-dimethyl-6-piperidin-1-yl-1,3,5-triazin-2-amine is sourced from PubChem (CID 4874050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).