C18H20BrNO4 — CID 4874613
9-bromo-2',2'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-dioxane]-4',6'-dione (PubChem CID 4874613) has the molecular formula C18H20BrNO4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 9-bromo-2',2'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-dioxane]-4',6'-dione.
| Compound Name | 9-bromo-2',2'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-dioxane]-4',6'-dione |
|---|---|
| PubChem CID | 4874613 |
| Molecular Formula | C18H20BrNO4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 9-bromo-2',2'-dimethylspiro[1,2,3,4,4a,6-hexahydrobenzo[c]quinolizine-5,5'-1,3-dioxane]-4',6'-dione |
| SMILES | CC1(C)OC(=O)C2(Cc3ccc(Br)cc3N3CCCCC32)C(=O)O1 |
| InChI | InChI=1S/C18H20BrNO4/c1-17(2)23-15(21)18(16(22)24-17)10-11-6-7-12(19)9-13(11)20-8-4-3-5-14(18)20/h6-7,9,14H,3-5,8,10H2,1-2H3 |
| InChIKey | VMTBPKGBGKEIFF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|